![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| TG Disted Gator.fxp | 2025-05-20 00:49 | 1.4K | |
| SY Those Were The Days.fxp | 2025-05-20 00:49 | 1.4K | |
| SY The BIG TONE.fxp | 2025-05-20 00:49 | 1.4K | |
| SY Synced Glitterstab.fxp | 2025-05-20 00:49 | 1.4K | |
| SY Sizzle Stack.fxp | 2025-05-20 00:49 | 1.4K | |
| SY Reverse Via Modweel.fxp | 2025-05-20 00:49 | 1.4K | |
| SY Modwheel Fm.fxp | 2025-05-20 00:49 | 1.4K | |
| SY Mega Ambientstack.fxp | 2025-05-20 00:49 | 1.4K | |
| SY Meat Love.fxp | 2025-05-20 00:49 | 1.4K | |
| SY Lonelyness.fxp | 2025-05-20 00:49 | 1.4K | |
| SY Gods Groove Seq.fxp | 2025-05-20 00:49 | 1.4K | |
| SY Expo 2000.fxp | 2025-05-20 00:49 | 1.4K | |
| SY Early Digi Days.fxp | 2025-05-20 00:49 | 1.4K | |
| SY Crushed Housestack.fxp | 2025-05-20 00:49 | 1.4K | |
| SY Cranked Bandpass.fxp | 2025-05-20 00:49 | 1.4K | |
| SY Belley Beauty.fxp | 2025-05-20 00:49 | 1.4K | |
| SY Basic Pulse Seq.fxp | 2025-05-20 00:49 | 1.4K | |
| SY 70`s Crumar Lead.fxp | 2025-05-20 00:49 | 1.4K | |
| SQ The Shmurgler.fxp | 2025-05-20 00:49 | 1.4K | |
| SQ The Bigtone Party.fxp | 2025-05-20 00:49 | 1.4K | |
| SQ Move The Modwheel.fxp | 2025-05-20 00:49 | 1.4K | |
| SQ French Kiss.fxp | 2025-05-20 00:49 | 1.4K | |
| SQ Electro Seq 01.fxp | 2025-05-20 00:49 | 1.4K | |
| SQ 1finger 303 03.fxp | 2025-05-20 00:49 | 1.4K | |
| SQ 1finger 303 02.fxp | 2025-05-20 00:49 | 1.4K | |
| SQ 1finger 303 01.fxp | 2025-05-20 00:49 | 1.4K | |
| PN Housy Stagepiano.fxp | 2025-05-20 00:49 | 1.4K | |
| PN Ballad Stagepiano.fxp | 2025-05-20 00:49 | 1.4K | |
| PD orion`s waves.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Unisphere.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Unicorns 2.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Unicorns 1.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Triggerdream.fxp | 2025-05-20 00:49 | 1.4K | |
| PD The Singing Ghost.fxp | 2025-05-20 00:49 | 1.4K | |
| PD The Rise.fxp | 2025-05-20 00:49 | 1.4K | |
| PD The Diamond Cave.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Table Arts Pad.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Syncope Arppad.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Sweet Driven Pad.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Star Twinkler Pad.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Smooth Groovepad.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Repetitive.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Red Planet.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Phatest On Planet.fxp | 2025-05-20 00:49 | 1.4K | |
| PD New Motion.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Moving Twinkler.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Lush Groovepad.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Lametta Pad.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Hold Wide Chord.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Granular Dream.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Gods Groove Pad.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Galadriel Dreaming.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Fifth Tinkle Swell.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Dreampad Split.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Deckards Dream.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Contact.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Constant Change.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Comin` Cold.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Bell Fx Pad.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Atreju`s Dream.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Arp Movement.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Arp Madness Pad.fxp | 2025-05-20 00:49 | 1.4K | |
| PD Accident In Paradise.fxp | 2025-05-20 00:49 | 1.4K | |
| PD 3d Pad.fxp | 2025-05-20 00:49 | 1.4K | |
| LD trance hymn MW.fxp | 2025-05-20 00:49 | 1.4K | |
| LD Terz-trance.fxp | 2025-05-20 00:49 | 1.4K | |
| LD Supertarncer.fxp | 2025-05-20 00:49 | 1.4K | |
| LD Snappy Megatrancer.fxp | 2025-05-20 00:49 | 1.4K | |
| LD Powertarnce.fxp | 2025-05-20 00:49 | 1.4K | |
| LD Hypertarncer.fxp | 2025-05-20 00:49 | 1.4K | |
| LD Dyn Loneleyness.fxp | 2025-05-20 00:49 | 1.4K | |
| LD Dirty Degraderlead.fxp | 2025-05-20 00:49 | 1.4K | |
| BA knockerbass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA _here_ You Go!.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Woodroom Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Well Defined Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Waldorf Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Velopulse Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Velo Pulse 01.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Velo-electrobass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA The Saturator.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Supersmacker.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Snap Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Smooth Degrader.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Smack That Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Sharp Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Seq Dance Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Robin S Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Reduced Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Punchy Dx Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Puncher.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Ordinary E-bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Oldschool Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Offbeat Tekkhead.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Move The Modwheel.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Mooglike Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Megapulser.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Love That Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Leather Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Hollowed Dance Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Hollowed Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Growling House Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Funk-house Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Fav. Housebass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Fat Seq Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Fat Anabass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Famous Microwve Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Dull Fm Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Dirty Velo Pulse.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Degraded Velo Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Clicking Degrader.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Click Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Breakdance Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA Attack Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA 106 Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA 90`s Dance Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| BA 80`s Seq Bass.fxp | 2025-05-20 00:49 | 1.4K | |
| AR Syncope Arp.fxp | 2025-05-20 00:49 | 1.4K | |
| AR Swirling Chord Arp.fxp | 2025-05-20 00:49 | 1.4K | |
| AR Styropore Filter.fxp | 2025-05-20 00:49 | 1.4K | |
| AR Squeeze Bass Arp 02.fxp | 2025-05-20 00:49 | 1.4K | |
| AR Squeeze Bass Arp 01.fxp | 2025-05-20 00:49 | 1.4K | |
| AR Random Pieces.fxp | 2025-05-20 00:49 | 1.4K | |
| AR Random Impressions.fxp | 2025-05-20 00:49 | 1.4K | |
| AR Random Driver.fxp | 2025-05-20 00:49 | 1.4K | |
| AR Once A Bell.fxp | 2025-05-20 00:49 | 1.4K | |
| AR Lonelyness On Mars.fxp | 2025-05-20 00:49 | 1.4K | |
| AR Delirium.fxp | 2025-05-20 00:49 | 1.4K | |